C21H18N4O — CID 87623768
5,7-dimethyl-3-(2-methylphenyl)-12-prop-2-ynoxy-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 87623768) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is 5,7-dimethyl-3-(2-methylphenyl)-12-prop-2-ynoxy-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 5,7-dimethyl-3-(2-methylphenyl)-12-prop-2-ynoxy-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 87623768 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 5,7-dimethyl-3-(2-methylphenyl)-12-prop-2-ynoxy-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | C#CCOc1ccc2nc(C)c3c(C)nc(-c4ccccc4C)n3c2n1 |
| InChI | InChI=1S/C21H18N4O/c1-5-12-26-18-11-10-17-21(24-18)25-19(14(3)22-17)15(4)23-20(25)16-9-7-6-8-13(16)2/h1,6-11H,12H2,2-4H3 |
| InChIKey | ZAVVZZDLXRWIRB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|