C12H17F6O3P — CID 87623809
4-[ethyl(1,1,1-trifluoropent-4-en-2-yloxy)phosphoryl]oxy-5,5,5-trifluoropent-1-ene (PubChem CID 87623809) has the molecular formula C12H17F6O3P and a molecular weight of 354.23 g/mol. Its IUPAC name is 4-[ethyl(1,1,1-trifluoropent-4-en-2-yloxy)phosphoryl]oxy-5,5,5-trifluoropent-1-ene.
| Compound Name | 4-[ethyl(1,1,1-trifluoropent-4-en-2-yloxy)phosphoryl]oxy-5,5,5-trifluoropent-1-ene |
|---|---|
| PubChem CID | 87623809 |
| Molecular Formula | C12H17F6O3P |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 4-[ethyl(1,1,1-trifluoropent-4-en-2-yloxy)phosphoryl]oxy-5,5,5-trifluoropent-1-ene |
| SMILES | C=CCC(OP(=O)(CC)OC(CC=C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H17F6O3P/c1-4-7-9(11(13,14)15)20-22(19,6-3)21-10(8-5-2)12(16,17)18/h4-5,9-10H,1-2,6-8H2,3H3 |
| InChIKey | NXGJSVSLDBFLOH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|