About 2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid
2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid (PubChem CID 87623873) has the molecular formula C6H4ClNO5
and a molecular weight of 205.55 g/mol. Its IUPAC name is 2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid.
Molecular Properties
| Compound Name | 2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid |
| PubChem CID | 87623873 |
| Molecular Formula | C6H4ClNO5 |
| Molecular Weight | 205.55 g/mol |
| Exact Mass | 204.98 |
| IUPAC Name | 2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid |
| SMILES | O=C(O)COc1cc(C(=O)Cl)on1 |
| InChI | InChI=1S/C6H4ClNO5/c7-6(11)3-1-4(8-13-3)12-2-5(9)10/h1H,2H2,(H,9,10) |
| InChIKey | WPLNOUWWVYTLFV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.55 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid?
The IUPAC name of 2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid (CID 87623873) is 2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid.
What is the SMILES notation for 2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid?
The canonical SMILES for 2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid is O=C(O)COc1cc(C(=O)Cl)on1.
What is the InChIKey of 2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid?
The InChIKey is WPLNOUWWVYTLFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO5/c7-6(11)3-1-4(8-13-3)12-2-5(9)10/h1H,2H2,(H,9,10).
What are the key properties of 2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid?
2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid has a molecular weight of 205.55 g/mol, XLogP of 0.52, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-carbonochloridoyl-1,2-oxazol-3-yl)oxy]acetic acid is sourced from PubChem (CID 87623873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).