C54H63O12S+ — CID 87624047
tris[3,5-dimethyl-4-(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)oxyphenyl]sulfanium (PubChem CID 87624047) has the molecular formula C54H63O12S+ and a molecular weight of 936.15 g/mol. Its IUPAC name is tris[3,5-dimethyl-4-(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)oxyphenyl]sulfanium.
| Compound Name | tris[3,5-dimethyl-4-(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)oxyphenyl]sulfanium |
|---|---|
| PubChem CID | 87624047 |
| Molecular Formula | C54H63O12S+ |
| Molecular Weight | 936.15 g/mol |
| Exact Mass | 935.40 |
| IUPAC Name | tris[3,5-dimethyl-4-(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)oxyphenyl]sulfanium |
| SMILES | Cc1cc([S+](c2cc(C)c(OC(=O)C34CCC(C)(C(=O)O3)C4(C)C)c(C)c2)c2cc(C)c(OC(=O)C34CCC(C)(C(=O)O3)C4(C)C)c(C)c2)cc(C)c1OC(=O)C12CCC(C)(C(=O)O1)C2(C)C |
| InChI | InChI=1S/C54H63O12S/c1-28-22-34(23-29(2)37(28)61-43(58)52-19-16-49(13,40(55)64-52)46(52,7)8)67(35-24-30(3)38(31(4)25-35)62-44(59)53-20-17-50(14,41(56)65-53)47(53,9)10)36-26-32(5)39(33(6)27-36)63-45(60)54-21-18-51(15,42(57)66-54)48(54,11)12/h22-27H,16-21H2,1-15H3/q+1 |
| InChIKey | TXQYMLYKZACJHA-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.15 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|