C21H24N6O2S3 — CID 87624255
6-amino-11-[ethyl(morpholin-4-yl)carbamothioyl]-8-thiophen-2-yl-4-thia-2,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-5-carboxamide (PubChem CID 87624255) has the molecular formula C21H24N6O2S3 and a molecular weight of 488.66 g/mol. Its IUPAC name is 6-amino-11-[ethyl(morpholin-4-yl)carbamothioyl]-8-thiophen-2-yl-4-thia-2,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-5-carboxamide.
| Compound Name | 6-amino-11-[ethyl(morpholin-4-yl)carbamothioyl]-8-thiophen-2-yl-4-thia-2,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 87624255 |
| Molecular Formula | C21H24N6O2S3 |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 6-amino-11-[ethyl(morpholin-4-yl)carbamothioyl]-8-thiophen-2-yl-4-thia-2,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-5-carboxamide |
| SMILES | CCN(C(=S)N1Cc2nc3sc(C(N)=O)c(N)c3c(-c3cccs3)c2C1)N1CCOCC1 |
| InChI | InChI=1S/C21H24N6O2S3/c1-2-27(26-5-7-29-8-6-26)21(30)25-10-12-13(11-25)24-20-16(15(12)14-4-3-9-31-14)17(22)18(32-20)19(23)28/h3-4,9H,2,5-8,10-11,22H2,1H3,(H2,23,28) |
| InChIKey | OAMLDZNYYCOCEL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|