C10H12F10O2S — CID 87624287
1,1,1,2,2-pentafluoro-3-(1,1,1,2,2-pentafluoropentan-3-ylsulfonyl)pentane (PubChem CID 87624287) has the molecular formula C10H12F10O2S and a molecular weight of 386.25 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-3-(1,1,1,2,2-pentafluoropentan-3-ylsulfonyl)pentane.
| Compound Name | 1,1,1,2,2-pentafluoro-3-(1,1,1,2,2-pentafluoropentan-3-ylsulfonyl)pentane |
|---|---|
| PubChem CID | 87624287 |
| Molecular Formula | C10H12F10O2S |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-3-(1,1,1,2,2-pentafluoropentan-3-ylsulfonyl)pentane |
| SMILES | CCC(C(F)(F)C(F)(F)F)S(=O)(=O)C(CC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F10O2S/c1-3-5(7(11,12)9(15,16)17)23(21,22)6(4-2)8(13,14)10(18,19)20/h5-6H,3-4H2,1-2H3 |
| InChIKey | MFVQGIIPHZBINV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|