C16H30O8SSi — CID 87624677
[(1S)-1-[(3aS,6S,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] methanesulfonate (PubChem CID 87624677) has the molecular formula C16H30O8SSi and a molecular weight of 410.56 g/mol. Its IUPAC name is [(1S)-1-[(3aS,6S,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] methanesulfonate.
| Compound Name | [(1S)-1-[(3aS,6S,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] methanesulfonate |
|---|---|
| PubChem CID | 87624677 |
| Molecular Formula | C16H30O8SSi |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [(1S)-1-[(3aS,6S,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] methanesulfonate |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H](CO[Si](C)(C)C(C)(C)C)OS(C)(=O)=O)OC(=O)[C@H]2O1 |
| InChI | InChI=1S/C16H30O8SSi/c1-15(2,3)26(7,8)20-9-10(24-25(6,18)19)11-12-13(14(17)21-11)23-16(4,5)22-12/h10-13H,9H2,1-8H3/t10-,11+,12-,13-/m0/s1 |
| InChIKey | FBLZBXNVTANUGL-RNJOBUHISA-N |
| XLogP | 1.80 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|