C14H21F6O3P — CID 87624874
4-[butyl(1,1,1-trifluoropent-4-en-2-yloxy)phosphoryl]oxy-5,5,5-trifluoropent-1-ene (PubChem CID 87624874) has the molecular formula C14H21F6O3P and a molecular weight of 382.28 g/mol. Its IUPAC name is 4-[butyl(1,1,1-trifluoropent-4-en-2-yloxy)phosphoryl]oxy-5,5,5-trifluoropent-1-ene.
| Compound Name | 4-[butyl(1,1,1-trifluoropent-4-en-2-yloxy)phosphoryl]oxy-5,5,5-trifluoropent-1-ene |
|---|---|
| PubChem CID | 87624874 |
| Molecular Formula | C14H21F6O3P |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-[butyl(1,1,1-trifluoropent-4-en-2-yloxy)phosphoryl]oxy-5,5,5-trifluoropent-1-ene |
| SMILES | C=CCC(OP(=O)(CCCC)OC(CC=C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H21F6O3P/c1-4-7-10-24(21,22-11(8-5-2)13(15,16)17)23-12(9-6-3)14(18,19)20/h5-6,11-12H,2-4,7-10H2,1H3 |
| InChIKey | ONWITNGTWMVVNB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|