C10H10O — CID 87624970
1a,2,3,3a-tetrahydronaphtho[1,2-b]oxirene (PubChem CID 87624970) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is 1a,2,3,3a-tetrahydronaphtho[1,2-b]oxirene.
| Compound Name | 1a,2,3,3a-tetrahydronaphtho[1,2-b]oxirene |
|---|---|
| PubChem CID | 87624970 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 1a,2,3,3a-tetrahydronaphtho[1,2-b]oxirene |
| SMILES | C1=CC2=C3OC3CCC2C=C1 |
| InChI | InChI=1S/C10H10O/c1-2-4-8-7(3-1)5-6-9-10(8)11-9/h1-4,7,9H,5-6H2 |
| InChIKey | ANXYZIONZUSNHC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|