About (2,3-difluorophenyl) ethanesulfonate
(2,3-difluorophenyl) ethanesulfonate (PubChem CID 87625112) has the molecular formula C8H8F2O3S
and a molecular weight of 222.21 g/mol. Its IUPAC name is (2,3-difluorophenyl) ethanesulfonate.
Molecular Properties
| Compound Name | (2,3-difluorophenyl) ethanesulfonate |
| PubChem CID | 87625112 |
| Molecular Formula | C8H8F2O3S |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | (2,3-difluorophenyl) ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cccc(F)c1F |
| InChI | InChI=1S/C8H8F2O3S/c1-2-14(11,12)13-7-5-3-4-6(9)8(7)10/h3-5H,2H2,1H3 |
| InChIKey | JPOYVCQGTDTACY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2,3-difluorophenyl) ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-difluorophenyl) ethanesulfonate?
The IUPAC name of (2,3-difluorophenyl) ethanesulfonate (CID 87625112) is (2,3-difluorophenyl) ethanesulfonate.
What is the SMILES notation for (2,3-difluorophenyl) ethanesulfonate?
The canonical SMILES for (2,3-difluorophenyl) ethanesulfonate is CCS(=O)(=O)Oc1cccc(F)c1F.
What is the InChIKey of (2,3-difluorophenyl) ethanesulfonate?
The InChIKey is JPOYVCQGTDTACY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2O3S/c1-2-14(11,12)13-7-5-3-4-6(9)8(7)10/h3-5H,2H2,1H3.
What are the key properties of (2,3-difluorophenyl) ethanesulfonate?
(2,3-difluorophenyl) ethanesulfonate has a molecular weight of 222.21 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-difluorophenyl) ethanesulfonate is sourced from PubChem (CID 87625112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).