C14H38O4S4Si4 — CID 87625325
[1-[1,1-bis[hydroxy(dimethyl)silyl]propyltetrasulfanyl]-1-[hydroxy(dimethyl)silyl]propyl]-hydroxy-dimethylsilane (PubChem CID 87625325) has the molecular formula C14H38O4S4Si4 and a molecular weight of 511.07 g/mol. Its IUPAC name is [1-[1,1-bis[hydroxy(dimethyl)silyl]propyltetrasulfanyl]-1-[hydroxy(dimethyl)silyl]propyl]-hydroxy-dimethylsilane.
| Compound Name | [1-[1,1-bis[hydroxy(dimethyl)silyl]propyltetrasulfanyl]-1-[hydroxy(dimethyl)silyl]propyl]-hydroxy-dimethylsilane |
|---|---|
| PubChem CID | 87625325 |
| Molecular Formula | C14H38O4S4Si4 |
| Molecular Weight | 511.07 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | [1-[1,1-bis[hydroxy(dimethyl)silyl]propyltetrasulfanyl]-1-[hydroxy(dimethyl)silyl]propyl]-hydroxy-dimethylsilane |
| SMILES | CCC(SSSSC(CC)([Si](C)(C)O)[Si](C)(C)O)([Si](C)(C)O)[Si](C)(C)O |
| InChI | InChI=1S/C14H38O4S4Si4/c1-11-13(23(3,4)15,24(5,6)16)19-21-22-20-14(12-2,25(7,8)17)26(9,10)18/h15-18H,11-12H2,1-10H3 |
| InChIKey | QBPOVVJYRLIWCB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.07 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|