C15H17ClFNO4S — CID 87625798
ethyl 6-[chloro-(4-fluorophenyl)sulfamoyl]cyclohexene-1-carboxylate (PubChem CID 87625798) has the molecular formula C15H17ClFNO4S and a molecular weight of 361.82 g/mol. Its IUPAC name is ethyl 6-[chloro-(4-fluorophenyl)sulfamoyl]cyclohexene-1-carboxylate.
| Compound Name | ethyl 6-[chloro-(4-fluorophenyl)sulfamoyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 87625798 |
| Molecular Formula | C15H17ClFNO4S |
| Molecular Weight | 361.82 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | ethyl 6-[chloro-(4-fluorophenyl)sulfamoyl]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCCC1S(=O)(=O)N(Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H17ClFNO4S/c1-2-22-15(19)13-5-3-4-6-14(13)23(20,21)18(16)12-9-7-11(17)8-10-12/h5,7-10,14H,2-4,6H2,1H3 |
| InChIKey | LMPWEAINXSQNMW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.82 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|