About 3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide
3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide (PubChem CID 87625857) has the molecular formula C12H10F6N2O4S3
and a molecular weight of 456.41 g/mol. Its IUPAC name is 3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide.
Molecular Properties
| Compound Name | 3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide |
| PubChem CID | 87625857 |
| Molecular Formula | C12H10F6N2O4S3 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 455.97 |
| IUPAC Name | 3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.c1ccc(C[n+]2ccsc2)cc1 |
| InChI | InChI=1S/C10H10NS.C2F6NO4S2/c1-2-4-10(5-3-1)8-11-6-7-12-9-11;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h1-7,9H,8H2;/q+1;-1 |
| InChIKey | MXVBPUBMYCIFAA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide?
The IUPAC name of 3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide (CID 87625857) is 3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide.
What is the SMILES notation for 3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide?
The canonical SMILES for 3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide is O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.c1ccc(C[n+]2ccsc2)cc1.
What is the InChIKey of 3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide?
The InChIKey is MXVBPUBMYCIFAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10NS.C2F6NO4S2/c1-2-4-10(5-3-1)8-11-6-7-12-9-11;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h1-7,9H,8H2;/q+1;-1.
What are the key properties of 3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide?
3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide has a molecular weight of 456.41 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1,3-thiazol-3-ium;bis(trifluoromethylsulfonyl)azanide is sourced from PubChem (CID 87625857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).