C30H31N3O3S — CID 87626032
(2-amino-9,9-dibenzyl-5,6,7,8-tetrahydrocyclohepta[d]pyrimidin-4-yl) 4-methylbenzenesulfonate (PubChem CID 87626032) has the molecular formula C30H31N3O3S and a molecular weight of 513.66 g/mol. Its IUPAC name is (2-amino-9,9-dibenzyl-5,6,7,8-tetrahydrocyclohepta[d]pyrimidin-4-yl) 4-methylbenzenesulfonate.
| Compound Name | (2-amino-9,9-dibenzyl-5,6,7,8-tetrahydrocyclohepta[d]pyrimidin-4-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87626032 |
| Molecular Formula | C30H31N3O3S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | (2-amino-9,9-dibenzyl-5,6,7,8-tetrahydrocyclohepta[d]pyrimidin-4-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2nc(N)nc3c2CCCCC3(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H31N3O3S/c1-22-15-17-25(18-16-22)37(34,35)36-28-26-14-8-9-19-30(27(26)32-29(31)33-28,20-23-10-4-2-5-11-23)21-24-12-6-3-7-13-24/h2-7,10-13,15-18H,8-9,14,19-21H2,1H3,(H2,31,32,33) |
| InChIKey | PBJNXDOZJZKMIH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|