About 1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide
1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide (PubChem CID 8762618) has the molecular formula C9H8N4O2S
and a molecular weight of 236.26 g/mol. Its IUPAC name is 1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide |
| PubChem CID | 8762618 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2nccs2)ccc1=O |
| InChI | InChI=1S/C9H8N4O2S/c1-13-7(14)3-2-6(12-13)8(15)11-9-10-4-5-16-9/h2-5H,1H3,(H,10,11,15) |
| InChIKey | SCYYZDDYWZMYMT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide?
The IUPAC name of 1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide (CID 8762618) is 1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide.
What is the SMILES notation for 1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide?
The canonical SMILES for 1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide is Cn1nc(C(=O)Nc2nccs2)ccc1=O.
What is the InChIKey of 1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide?
The InChIKey is SCYYZDDYWZMYMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O2S/c1-13-7(14)3-2-6(12-13)8(15)11-9-10-4-5-16-9/h2-5H,1H3,(H,10,11,15).
What are the key properties of 1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide?
1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide has a molecular weight of 236.26 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-oxo-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide is sourced from PubChem (CID 8762618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).