About 3-cyclohexyl-5-phenyl-1,2,4-oxadiazole
3-cyclohexyl-5-phenyl-1,2,4-oxadiazole (PubChem CID 876263) has the molecular formula C14H16N2O
and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-cyclohexyl-5-phenyl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-cyclohexyl-5-phenyl-1,2,4-oxadiazole |
| PubChem CID | 876263 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-cyclohexyl-5-phenyl-1,2,4-oxadiazole |
| SMILES | c1ccc(-c2nc(C3CCCCC3)no2)cc1 |
| InChI | InChI=1S/C14H16N2O/c1-3-7-11(8-4-1)13-15-14(17-16-13)12-9-5-2-6-10-12/h2,5-6,9-11H,1,3-4,7-8H2 |
| InChIKey | BOMTUBVUSUAXBH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexyl-5-phenyl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-5-phenyl-1,2,4-oxadiazole?
The IUPAC name of 3-cyclohexyl-5-phenyl-1,2,4-oxadiazole (CID 876263) is 3-cyclohexyl-5-phenyl-1,2,4-oxadiazole.
What is the SMILES notation for 3-cyclohexyl-5-phenyl-1,2,4-oxadiazole?
The canonical SMILES for 3-cyclohexyl-5-phenyl-1,2,4-oxadiazole is c1ccc(-c2nc(C3CCCCC3)no2)cc1.
What is the InChIKey of 3-cyclohexyl-5-phenyl-1,2,4-oxadiazole?
The InChIKey is BOMTUBVUSUAXBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O/c1-3-7-11(8-4-1)13-15-14(17-16-13)12-9-5-2-6-10-12/h2,5-6,9-11H,1,3-4,7-8H2.
What are the key properties of 3-cyclohexyl-5-phenyl-1,2,4-oxadiazole?
3-cyclohexyl-5-phenyl-1,2,4-oxadiazole has a molecular weight of 228.30 g/mol, XLogP of 3.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-5-phenyl-1,2,4-oxadiazole is sourced from PubChem (CID 876263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).