C10H11N5O5S — CID 87626516
methyl 5-carbamoyl-9-oxo-10-sulfanyloxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxylate (PubChem CID 87626516) has the molecular formula C10H11N5O5S and a molecular weight of 313.30 g/mol. Its IUPAC name is methyl 5-carbamoyl-9-oxo-10-sulfanyloxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxylate.
| Compound Name | methyl 5-carbamoyl-9-oxo-10-sulfanyloxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxylate |
|---|---|
| PubChem CID | 87626516 |
| Molecular Formula | C10H11N5O5S |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | methyl 5-carbamoyl-9-oxo-10-sulfanyloxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxylate |
| SMILES | COC(=O)C1c2c(cnn2C(N)=O)C2CN1C(=O)N2OS |
| InChI | InChI=1S/C10H11N5O5S/c1-19-8(16)7-6-4(2-12-14(6)9(11)17)5-3-13(7)10(18)15(5)20-21/h2,5,7,21H,3H2,1H3,(H2,11,17) |
| InChIKey | QZJJFAFSTCPSRU-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|