morpholine;sulfamoyl chloride

C4H11ClN2O3S — CID 87626525

IUPACmorpholine;sulfamoyl chloride
SMILESC1COCCN1.NS(=O)(=O)Cl
InChIInChI=1S/C4H9NO.ClH2NO2S/c1-3-6-4-2-5-1;1-5(2,3)4/h5H,1-4H2;(H2,2,3,4)
InChIKeyWRWRSTIBNSZCNV-UHFFFAOYSA-N
MW202.66 g/mol
LogP-0.97
Rot. Bonds

About morpholine;sulfamoyl chloride

morpholine;sulfamoyl chloride (PubChem CID 87626525) has the molecular formula C4H11ClN2O3S and a molecular weight of 202.66 g/mol. Its IUPAC name is morpholine;sulfamoyl chloride.

Molecular Properties

Compound Namemorpholine;sulfamoyl chloride
PubChem CID87626525
Molecular FormulaC4H11ClN2O3S
Molecular Weight202.66 g/mol
Exact Mass202.02
IUPAC Namemorpholine;sulfamoyl chloride
SMILESC1COCCN1.NS(=O)(=O)Cl
InChIInChI=1S/C4H9NO.ClH2NO2S/c1-3-6-4-2-5-1;1-5(2,3)4/h5H,1-4H2;(H2,2,3,4)
InChIKeyWRWRSTIBNSZCNV-UHFFFAOYSA-N
XLogP-0.97
TPSA81.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.66
LogP ≤ 5-0.97
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze morpholine;sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of morpholine;sulfamoyl chloride?
The IUPAC name of morpholine;sulfamoyl chloride (CID 87626525) is morpholine;sulfamoyl chloride.
What is the SMILES notation for morpholine;sulfamoyl chloride?
The canonical SMILES for morpholine;sulfamoyl chloride is C1COCCN1.NS(=O)(=O)Cl.
What is the InChIKey of morpholine;sulfamoyl chloride?
The InChIKey is WRWRSTIBNSZCNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.ClH2NO2S/c1-3-6-4-2-5-1;1-5(2,3)4/h5H,1-4H2;(H2,2,3,4).
What are the key properties of morpholine;sulfamoyl chloride?
morpholine;sulfamoyl chloride has a molecular weight of 202.66 g/mol, XLogP of -0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;sulfamoyl chloride is sourced from PubChem (CID 87626525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).