C16H12F3N3O3S2 — CID 87626556
9-oxo-10-sulfanyloxy-4-[2-(trifluoromethyl)phenyl]-5-thia-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide (PubChem CID 87626556) has the molecular formula C16H12F3N3O3S2 and a molecular weight of 415.42 g/mol. Its IUPAC name is 9-oxo-10-sulfanyloxy-4-[2-(trifluoromethyl)phenyl]-5-thia-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide.
| Compound Name | 9-oxo-10-sulfanyloxy-4-[2-(trifluoromethyl)phenyl]-5-thia-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide |
|---|---|
| PubChem CID | 87626556 |
| Molecular Formula | C16H12F3N3O3S2 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 9-oxo-10-sulfanyloxy-4-[2-(trifluoromethyl)phenyl]-5-thia-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxamide |
| SMILES | NC(=O)C1c2sc(-c3ccccc3C(F)(F)F)cc2C2CN1C(=O)N2OS |
| InChI | InChI=1S/C16H12F3N3O3S2/c17-16(18,19)9-4-2-1-3-7(9)11-5-8-10-6-21(15(24)22(10)25-26)12(14(20)23)13(8)27-11/h1-5,10,12,26H,6H2,(H2,20,23) |
| InChIKey | DCRNIZNAKGXLKR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|