About ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione
ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione (PubChem CID 87627108) has the molecular formula C6H9NO4S
and a molecular weight of 191.21 g/mol. Its IUPAC name is ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione |
| PubChem CID | 87627108 |
| Molecular Formula | C6H9NO4S |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione |
| SMILES | CC(=O)S.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C4H5NO3.C2H4OS/c6-3-1-2-4(7)5(3)8;1-2(3)4/h8H,1-2H2;1H3,(H,3,4) |
| InChIKey | QTUBPZNBYOMOKW-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione?
The IUPAC name of ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione (CID 87627108) is ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione.
What is the SMILES notation for ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione?
The canonical SMILES for ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione is CC(=O)S.O=C1CCC(=O)N1O.
What is the InChIKey of ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione?
The InChIKey is QTUBPZNBYOMOKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3.C2H4OS/c6-3-1-2-4(7)5(3)8;1-2(3)4/h8H,1-2H2;1H3,(H,3,4).
What are the key properties of ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione?
ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione has a molecular weight of 191.21 g/mol, XLogP of -0.01, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanethioic S-acid;1-hydroxypyrrolidine-2,5-dione is sourced from PubChem (CID 87627108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).