C7H9N5O2 — CID 87627145
2-amino-4-oxo-2,3,4a,8-tetrahydropteridine-5-carbaldehyde (PubChem CID 87627145) has the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. Its IUPAC name is 2-amino-4-oxo-2,3,4a,8-tetrahydropteridine-5-carbaldehyde.
| Compound Name | 2-amino-4-oxo-2,3,4a,8-tetrahydropteridine-5-carbaldehyde |
|---|---|
| PubChem CID | 87627145 |
| Molecular Formula | C7H9N5O2 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 2-amino-4-oxo-2,3,4a,8-tetrahydropteridine-5-carbaldehyde |
| SMILES | NC1N=C2NC=CN(C=O)C2C(=O)N1 |
| InChI | InChI=1S/C7H9N5O2/c8-7-10-5-4(6(14)11-7)12(3-13)2-1-9-5/h1-4,7H,8H2,(H,9,10)(H,11,14) |
| InChIKey | YRFLGRUFHHQLRP-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|