C8H2Cl4O5 — CID 87627274
2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride (PubChem CID 87627274) has the molecular formula C8H2Cl4O5 and a molecular weight of 319.91 g/mol. Its IUPAC name is 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride.
| Compound Name | 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride |
|---|---|
| PubChem CID | 87627274 |
| Molecular Formula | C8H2Cl4O5 |
| Molecular Weight | 319.91 g/mol |
| Exact Mass | 317.87 |
| IUPAC Name | 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride |
| SMILES | O=C(Cl)C1=C(C(=O)Cl)C(C(=O)Cl)OC1C(=O)Cl |
| InChI | InChI=1S/C8H2Cl4O5/c9-5(13)1-2(6(10)14)4(8(12)16)17-3(1)7(11)15/h3-4H |
| InChIKey | RCPMTBOPYWSGPU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.91 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|