2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride

C8H2Cl4O5 — CID 87627274

IUPAC2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride
SMILESO=C(Cl)C1=C(C(=O)Cl)C(C(=O)Cl)OC1C(=O)Cl
InChIInChI=1S/C8H2Cl4O5/c9-5(13)1-2(6(10)14)4(8(12)16)17-3(1)7(11)15/h3-4H
InChIKeyRCPMTBOPYWSGPU-UHFFFAOYSA-N
MW319.91 g/mol
LogP1.11
Rot. Bonds4

About 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride

2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride (PubChem CID 87627274) has the molecular formula C8H2Cl4O5 and a molecular weight of 319.91 g/mol. Its IUPAC name is 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride.

Molecular Properties

Compound Name2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride
PubChem CID87627274
Molecular FormulaC8H2Cl4O5
Molecular Weight319.91 g/mol
Exact Mass317.87
IUPAC Name2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride
SMILESO=C(Cl)C1=C(C(=O)Cl)C(C(=O)Cl)OC1C(=O)Cl
InChIInChI=1S/C8H2Cl4O5/c9-5(13)1-2(6(10)14)4(8(12)16)17-3(1)7(11)15/h3-4H
InChIKeyRCPMTBOPYWSGPU-UHFFFAOYSA-N
XLogP1.11
TPSA77.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.91
LogP ≤ 51.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride?
The IUPAC name of 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride (CID 87627274) is 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride.
What is the SMILES notation for 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride?
The canonical SMILES for 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride is O=C(Cl)C1=C(C(=O)Cl)C(C(=O)Cl)OC1C(=O)Cl.
What is the InChIKey of 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride?
The InChIKey is RCPMTBOPYWSGPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2Cl4O5/c9-5(13)1-2(6(10)14)4(8(12)16)17-3(1)7(11)15/h3-4H.
What are the key properties of 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride?
2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride has a molecular weight of 319.91 g/mol, XLogP of 1.11, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydrofuran-2,3,4,5-tetracarbonyl chloride is sourced from PubChem (CID 87627274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).