About [(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate
[(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate (PubChem CID 8762750) has the molecular formula C24H28N2O2
and a molecular weight of 376.50 g/mol. Its IUPAC name is [(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate.
Molecular Properties
| Compound Name | [(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate |
| PubChem CID | 8762750 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate |
| SMILES | CN(C)C[C@@]1(OC(=O)c2ccccc2)CCC[C@](C#N)(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H28N2O2/c1-26(2)19-24(28-22(27)20-10-5-3-6-11-20)15-9-14-23(18-25,16-17-24)21-12-7-4-8-13-21/h3-8,10-13H,9,14-17,19H2,1-2H3/t23-,24+/m0/s1 |
| InChIKey | VMXMVTQWWINVBO-BJKOFHAPSA-N |
| XLogP | 4.57 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate?
The IUPAC name of [(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate (CID 8762750) is [(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate.
What is the SMILES notation for [(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate?
The canonical SMILES for [(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate is CN(C)C[C@@]1(OC(=O)c2ccccc2)CCC[C@](C#N)(c2ccccc2)CC1.
What is the InChIKey of [(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate?
The InChIKey is VMXMVTQWWINVBO-BJKOFHAPSA-N. The full InChI is InChI=1S/C24H28N2O2/c1-26(2)19-24(28-22(27)20-10-5-3-6-11-20)15-9-14-23(18-25,16-17-24)21-12-7-4-8-13-21/h3-8,10-13H,9,14-17,19H2,1-2H3/t23-,24+/m0/s1.
What are the key properties of [(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate?
[(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate has a molecular weight of 376.50 g/mol, XLogP of 4.57, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,4R)-4-cyano-1-[(dimethylamino)methyl]-4-phenylcycloheptyl] benzoate is sourced from PubChem (CID 8762750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).