C26H50O3Si — CID 87627634
(3R)-3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-8,8,8-trideuterio-7-hydroxy-3-methyl-2-(trideuteriomethyl)octanal (PubChem CID 87627634) has the molecular formula C26H50O3Si and a molecular weight of 444.81 g/mol. Its IUPAC name is (3R)-3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-8,8,8-trideuterio-7-hydroxy-3-methyl-2-(trideuteriomethyl)octanal.
| Compound Name | (3R)-3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-8,8,8-trideuterio-7-hydroxy-3-methyl-2-(trideuteriomethyl)octanal |
|---|---|
| PubChem CID | 87627634 |
| Molecular Formula | C26H50O3Si |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.39 |
| IUPAC Name | (3R)-3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-8,8,8-trideuterio-7-hydroxy-3-methyl-2-(trideuteriomethyl)octanal |
| SMILES | [2H]C([2H])([2H])C(O)CCC[C@@](C)(C(C=O)C([2H])([2H])[2H])[C@@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C26H50O3Si/c1-19(18-27)25(6,16-10-12-20(2)28)23-15-14-21-22(13-11-17-26(21,23)7)29-30(8,9)24(3,4)5/h18-23,28H,10-17H2,1-9H3/t19?,20?,21-,22-,23-,25-,26-/m0/s1/i1D3,2D3 |
| InChIKey | UUOAOVXINIIUQI-SCTIJRGQSA-N |
| XLogP | 6.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|