C18H13F6N5O2 — CID 87628080
4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2,4-oxadiazol-3-yl]methyl-(2,2,2-trifluoroethyl)amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 87628080) has the molecular formula C18H13F6N5O2 and a molecular weight of 445.32 g/mol. Its IUPAC name is 4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2,4-oxadiazol-3-yl]methyl-(2,2,2-trifluoroethyl)amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2,4-oxadiazol-3-yl]methyl-(2,2,2-trifluoroethyl)amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 87628080 |
| Molecular Formula | C18H13F6N5O2 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2,4-oxadiazol-3-yl]methyl-(2,2,2-trifluoroethyl)amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | Cc1noc(C)c1-c1nc(CN(CC(F)(F)F)c2ccc(C#N)c(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C18H13F6N5O2/c1-9-15(10(2)30-27-9)16-26-14(28-31-16)7-29(8-17(19,20)21)12-4-3-11(6-25)13(5-12)18(22,23)24/h3-5H,7-8H2,1-2H3 |
| InChIKey | IUZGLNQWNVHQGI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 91.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |