About cobalt(3+);1H-inden-1-ylmethanone;dichloride
cobalt(3+);1H-inden-1-ylmethanone;dichloride (PubChem CID 87628331) has the molecular formula C10H7Cl2CoO
and a molecular weight of 273.00 g/mol. Its IUPAC name is cobalt(3+);1H-inden-1-ylmethanone;dichloride.
Molecular Properties
| Compound Name | cobalt(3+);1H-inden-1-ylmethanone;dichloride |
| PubChem CID | 87628331 |
| Molecular Formula | C10H7Cl2CoO |
| Molecular Weight | 273.00 g/mol |
| Exact Mass | 271.92 |
| IUPAC Name | cobalt(3+);1H-inden-1-ylmethanone;dichloride |
| SMILES | O=[C-]C1C=Cc2ccccc21.[Cl-].[Cl-].[Co+3] |
| InChI | InChI=1S/C10H7O.2ClH.Co/c11-7-9-6-5-8-3-1-2-4-10(8)9;;;/h1-6,9H;2*1H;/q-1;;;+3/p-2 |
| InChIKey | UTSHHVUIZDSFEN-UHFFFAOYSA-L |
| XLogP | -4.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.00 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt(3+);1H-inden-1-ylmethanone;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(3+);1H-inden-1-ylmethanone;dichloride?
The IUPAC name of cobalt(3+);1H-inden-1-ylmethanone;dichloride (CID 87628331) is cobalt(3+);1H-inden-1-ylmethanone;dichloride.
What is the SMILES notation for cobalt(3+);1H-inden-1-ylmethanone;dichloride?
The canonical SMILES for cobalt(3+);1H-inden-1-ylmethanone;dichloride is O=[C-]C1C=Cc2ccccc21.[Cl-].[Cl-].[Co+3].
What is the InChIKey of cobalt(3+);1H-inden-1-ylmethanone;dichloride?
The InChIKey is UTSHHVUIZDSFEN-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H7O.2ClH.Co/c11-7-9-6-5-8-3-1-2-4-10(8)9;;;/h1-6,9H;2*1H;/q-1;;;+3/p-2.
What are the key properties of cobalt(3+);1H-inden-1-ylmethanone;dichloride?
cobalt(3+);1H-inden-1-ylmethanone;dichloride has a molecular weight of 273.00 g/mol, XLogP of -4.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(3+);1H-inden-1-ylmethanone;dichloride is sourced from PubChem (CID 87628331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).