C33H26Cl2F9N3O5 — CID 87628504
N-[(3R,4R)-3-(3,4-dichlorophenyl)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidin-4-yl]-N-methyl-3,5-bis(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 87628504) has the molecular formula C33H26Cl2F9N3O5 and a molecular weight of 786.48 g/mol. Its IUPAC name is N-[(3R,4R)-3-(3,4-dichlorophenyl)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidin-4-yl]-N-methyl-3,5-bis(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3R,4R)-3-(3,4-dichlorophenyl)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidin-4-yl]-N-methyl-3,5-bis(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87628504 |
| Molecular Formula | C33H26Cl2F9N3O5 |
| Molecular Weight | 786.48 g/mol |
| Exact Mass | 785.11 |
| IUPAC Name | N-[(3R,4R)-3-(3,4-dichlorophenyl)-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]piperidin-4-yl]-N-methyl-3,5-bis(trifluoromethyl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@@H]1CCN(CCN2C(=O)c3ccccc3C2=O)C[C@H]1c1ccc(Cl)c(Cl)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H25Cl2F6N3O3.C2HF3O2/c1-40(27(43)18-12-19(30(34,35)36)15-20(13-18)31(37,38)39)26-8-9-41(16-23(26)17-6-7-24(32)25(33)14-17)10-11-42-28(44)21-4-2-3-5-22(21)29(42)45;3-2(4,5)1(6)7/h2-7,12-15,23,26H,8-11,16H2,1H3;(H,6,7)/t23-,26+;/m0./s1 |
| InChIKey | KBMXFSDVTWUZMR-HWJSIUBNSA-N |
| XLogP | 7.89 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.48 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|