C16H18N2OS — CID 87629077
12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-4-carbothioic S-acid (PubChem CID 87629077) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-4-carbothioic S-acid.
| Compound Name | 12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-4-carbothioic S-acid |
|---|---|
| PubChem CID | 87629077 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-4-carbothioic S-acid |
| SMILES | Cc1ccc2c(c1)c1c3n2CCN(C(=O)S)C3CCC1 |
| InChI | InChI=1S/C16H18N2OS/c1-10-5-6-13-12(9-10)11-3-2-4-14-15(11)17(13)7-8-18(14)16(19)20/h5-6,9,14H,2-4,7-8H2,1H3,(H,19,20) |
| InChIKey | PEOMSPRJEOANSB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 25.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|