C13H16N2 — CID 87629165
2,3,4,10a-tetrahydro-1H-acridin-10-amine (PubChem CID 87629165) has the molecular formula C13H16N2 and a molecular weight of 200.29 g/mol. Its IUPAC name is 2,3,4,10a-tetrahydro-1H-acridin-10-amine.
| Compound Name | 2,3,4,10a-tetrahydro-1H-acridin-10-amine |
|---|---|
| PubChem CID | 87629165 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2,3,4,10a-tetrahydro-1H-acridin-10-amine |
| SMILES | NN1C2=C(C=C3C=CC=CC31)CCCC2 |
| InChI | InChI=1S/C13H16N2/c14-15-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15/h1,3,5,7,9,12H,2,4,6,8,14H2 |
| InChIKey | PZSWRPUBOYDDCV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|