About 3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid
3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid (PubChem CID 87629412) has the molecular formula C26H22ClN3O2
and a molecular weight of 443.93 g/mol. Its IUPAC name is 3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid |
| PubChem CID | 87629412 |
| Molecular Formula | C26H22ClN3O2 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid |
| SMILES | Cc1ccccc1-c1cccc2c(CCCn3ccc4ccnc(Cl)c43)c(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C26H22ClN3O2/c1-16-6-2-3-7-18(16)19-8-4-9-20-21(23(26(31)32)29-22(19)20)10-5-14-30-15-12-17-11-13-28-25(27)24(17)30/h2-4,6-9,11-13,15,29H,5,10,14H2,1H3,(H,31,32) |
| InChIKey | LIUYVRZERKLGDA-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid?
The IUPAC name of 3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid (CID 87629412) is 3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid.
What is the SMILES notation for 3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid?
The canonical SMILES for 3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid is Cc1ccccc1-c1cccc2c(CCCn3ccc4ccnc(Cl)c43)c(C(=O)O)[nH]c12.
What is the InChIKey of 3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid?
The InChIKey is LIUYVRZERKLGDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22ClN3O2/c1-16-6-2-3-7-18(16)19-8-4-9-20-21(23(26(31)32)29-22(19)20)10-5-14-30-15-12-17-11-13-28-25(27)24(17)30/h2-4,6-9,11-13,15,29H,5,10,14H2,1H3,(H,31,32).
What are the key properties of 3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid?
3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid has a molecular weight of 443.93 g/mol, XLogP of 6.48, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(7-chloropyrrolo[2,3-c]pyridin-1-yl)propyl]-7-(2-methylphenyl)-1H-indole-2-carboxylic acid is sourced from PubChem (CID 87629412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).