C16H7F6NO2S — CID 87630214
(Z)-2-[(4-fluorophenyl)methylsulfonyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile (PubChem CID 87630214) has the molecular formula C16H7F6NO2S and a molecular weight of 391.29 g/mol. Its IUPAC name is (Z)-2-[(4-fluorophenyl)methylsulfonyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[(4-fluorophenyl)methylsulfonyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 87630214 |
| Molecular Formula | C16H7F6NO2S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | (Z)-2-[(4-fluorophenyl)methylsulfonyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1c(F)c(F)c(F)c(F)c1F)S(=O)(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H7F6NO2S/c17-9-3-1-8(2-4-9)7-26(24,25)10(6-23)5-11-12(18)14(20)16(22)15(21)13(11)19/h1-5H,7H2/b10-5- |
| InChIKey | QPSYEWHKMGKHGA-YHYXMXQVSA-N |
| XLogP | 4.00 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|