C6H11F2O9P — CID 87630343
[(2R,3R,4S,5R)-5-fluoro-5-fluorooxy-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate (PubChem CID 87630343) has the molecular formula C6H11F2O9P and a molecular weight of 296.12 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-fluoro-5-fluorooxy-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-5-fluoro-5-fluorooxy-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87630343 |
| Molecular Formula | C6H11F2O9P |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | [(2R,3R,4S,5R)-5-fluoro-5-fluorooxy-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate |
| SMILES | O=C[C@@](F)(OF)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C6H11F2O9P/c7-6(2-9,17-8)5(12)4(11)3(10)1-16-18(13,14)15/h2-5,10-12H,1H2,(H2,13,14,15)/t3-,4-,5+,6-/m1/s1 |
| InChIKey | NGGZXNXKODCYRV-ARQDHWQXSA-N |
| XLogP | -2.06 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|