About N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide
N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide (PubChem CID 87630541) has the molecular formula C18H22N2O
and a molecular weight of 282.39 g/mol. Its IUPAC name is N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide |
| PubChem CID | 87630541 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide |
| SMILES | CC(=O)NC1=CC=CC(N)(/C=C/c2c(C)cccc2C)C1 |
| InChI | InChI=1S/C18H22N2O/c1-13-6-4-7-14(2)17(13)9-11-18(19)10-5-8-16(12-18)20-15(3)21/h4-11H,12,19H2,1-3H3,(H,20,21)/b11-9+ |
| InChIKey | SVANHTAHDAVEND-PKNBQFBNSA-N |
| XLogP | 2.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide?
The IUPAC name of N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide (CID 87630541) is N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide.
What is the SMILES notation for N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide?
The canonical SMILES for N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide is CC(=O)NC1=CC=CC(N)(/C=C/c2c(C)cccc2C)C1.
What is the InChIKey of N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide?
The InChIKey is SVANHTAHDAVEND-PKNBQFBNSA-N. The full InChI is InChI=1S/C18H22N2O/c1-13-6-4-7-14(2)17(13)9-11-18(19)10-5-8-16(12-18)20-15(3)21/h4-11H,12,19H2,1-3H3,(H,20,21)/b11-9+.
What are the key properties of N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide?
N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide has a molecular weight of 282.39 g/mol, XLogP of 2.99, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-amino-5-[(E)-2-(2,6-dimethylphenyl)ethenyl]cyclohexa-1,3-dien-1-yl]acetamide is sourced from PubChem (CID 87630541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).