C20H14O8S2 — CID 87630571
cyclohexa-2,5-diene-1,4-dione;phenanthrene-1,2-disulfonic acid (PubChem CID 87630571) has the molecular formula C20H14O8S2 and a molecular weight of 446.46 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;phenanthrene-1,2-disulfonic acid.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;phenanthrene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 87630571 |
| Molecular Formula | C20H14O8S2 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;phenanthrene-1,2-disulfonic acid |
| SMILES | O=C1C=CC(=O)C=C1.O=S(=O)(O)c1ccc2c(ccc3ccccc32)c1S(=O)(=O)O |
| InChI | InChI=1S/C14H10O6S2.C6H4O2/c15-21(16,17)13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)22(18,19)20;7-5-1-2-6(8)4-3-5/h1-8H,(H,15,16,17)(H,18,19,20);1-4H |
| InChIKey | REPJXAYPJJDIAN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|