About 1,1-diethoxyethane;(E)-2-ethylhex-2-enal
1,1-diethoxyethane;(E)-2-ethylhex-2-enal (PubChem CID 87630988) has the molecular formula C14H28O3
and a molecular weight of 244.37 g/mol. Its IUPAC name is 1,1-diethoxyethane;(E)-2-ethylhex-2-enal.
Molecular Properties
| Compound Name | 1,1-diethoxyethane;(E)-2-ethylhex-2-enal |
| PubChem CID | 87630988 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 1,1-diethoxyethane;(E)-2-ethylhex-2-enal |
| SMILES | CCC/C=C(/C=O)CC.CCOC(C)OCC |
| InChI | InChI=1S/C8H14O.C6H14O2/c1-3-5-6-8(4-2)7-9;1-4-7-6(3)8-5-2/h6-7H,3-5H2,1-2H3;6H,4-5H2,1-3H3/b8-6+; |
| InChIKey | IGUNUGIBQNUXKM-WVLIHFOGSA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethoxyethane;(E)-2-ethylhex-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethoxyethane;(E)-2-ethylhex-2-enal?
The IUPAC name of 1,1-diethoxyethane;(E)-2-ethylhex-2-enal (CID 87630988) is 1,1-diethoxyethane;(E)-2-ethylhex-2-enal.
What is the SMILES notation for 1,1-diethoxyethane;(E)-2-ethylhex-2-enal?
The canonical SMILES for 1,1-diethoxyethane;(E)-2-ethylhex-2-enal is CCC/C=C(/C=O)CC.CCOC(C)OCC.
What is the InChIKey of 1,1-diethoxyethane;(E)-2-ethylhex-2-enal?
The InChIKey is IGUNUGIBQNUXKM-WVLIHFOGSA-N. The full InChI is InChI=1S/C8H14O.C6H14O2/c1-3-5-6-8(4-2)7-9;1-4-7-6(3)8-5-2/h6-7H,3-5H2,1-2H3;6H,4-5H2,1-3H3/b8-6+;.
What are the key properties of 1,1-diethoxyethane;(E)-2-ethylhex-2-enal?
1,1-diethoxyethane;(E)-2-ethylhex-2-enal has a molecular weight of 244.37 g/mol, XLogP of 3.73, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethoxyethane;(E)-2-ethylhex-2-enal is sourced from PubChem (CID 87630988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).