C29H22F6S2 — CID 87631391
2-ethyl-3-[2-(2-ethyl-5-phenylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-phenylthiophene (PubChem CID 87631391) has the molecular formula C29H22F6S2 and a molecular weight of 548.62 g/mol. Its IUPAC name is 2-ethyl-3-[2-(2-ethyl-5-phenylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-phenylthiophene.
| Compound Name | 2-ethyl-3-[2-(2-ethyl-5-phenylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-phenylthiophene |
|---|---|
| PubChem CID | 87631391 |
| Molecular Formula | C29H22F6S2 |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 2-ethyl-3-[2-(2-ethyl-5-phenylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-phenylthiophene |
| SMILES | CCc1sc(-c2ccccc2)cc1C1=C(c2cc(-c3ccccc3)sc2CC)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C29H22F6S2/c1-3-21-19(15-23(36-21)17-11-7-5-8-12-17)25-26(28(32,33)29(34,35)27(25,30)31)20-16-24(37-22(20)4-2)18-13-9-6-10-14-18/h5-16H,3-4H2,1-2H3 |
| InChIKey | ZMLVJTPVUOIYFX-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|