About bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel
bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel (PubChem CID 87631405) has the molecular formula C32H28ClN8Ni
and a molecular weight of 618.78 g/mol. Its IUPAC name is bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel.
Molecular Properties
| Compound Name | bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel |
| PubChem CID | 87631405 |
| Molecular Formula | C32H28ClN8Ni |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel |
| SMILES | Cc1cccc(-c2ccc(-c3cccc(C)n3)nn2)n1.Cc1cccc(-c2ccc(-c3cccc(C)n3)nn2)n1.Cl[Ni] |
| InChI | InChI=1S/2C16H14N4.ClH.Ni/c2*1-11-5-3-7-13(17-11)15-9-10-16(20-19-15)14-8-4-6-12(2)18-14;;/h2*3-10H,1-2H3;1H;/q;;;+1/p-1 |
| InChIKey | UPAFFSHBECNCOJ-UHFFFAOYSA-M |
| XLogP | 7.12 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel?
The IUPAC name of bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel (CID 87631405) is bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel.
What is the SMILES notation for bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel?
The canonical SMILES for bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel is Cc1cccc(-c2ccc(-c3cccc(C)n3)nn2)n1.Cc1cccc(-c2ccc(-c3cccc(C)n3)nn2)n1.Cl[Ni].
What is the InChIKey of bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel?
The InChIKey is UPAFFSHBECNCOJ-UHFFFAOYSA-M. The full InChI is InChI=1S/2C16H14N4.ClH.Ni/c2*1-11-5-3-7-13(17-11)15-9-10-16(20-19-15)14-8-4-6-12(2)18-14;;/h2*3-10H,1-2H3;1H;/q;;;+1/p-1.
What are the key properties of bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel?
bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel has a molecular weight of 618.78 g/mol, XLogP of 7.12, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,6-bis(6-methyl-2-pyridinyl)pyridazine);chloronickel is sourced from PubChem (CID 87631405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).