C28H20F5N5O2S — CID 87631430
2,3,4,5,6-pentafluoro-N-[[3-[4-(methylamino)quinazolin-6-yl]phenyl]methyl]-N-(pyridin-2-ylmethyl)benzenesulfonamide (PubChem CID 87631430) has the molecular formula C28H20F5N5O2S and a molecular weight of 585.56 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[3-[4-(methylamino)quinazolin-6-yl]phenyl]methyl]-N-(pyridin-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[3-[4-(methylamino)quinazolin-6-yl]phenyl]methyl]-N-(pyridin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 87631430 |
| Molecular Formula | C28H20F5N5O2S |
| Molecular Weight | 585.56 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[3-[4-(methylamino)quinazolin-6-yl]phenyl]methyl]-N-(pyridin-2-ylmethyl)benzenesulfonamide |
| SMILES | CNc1ncnc2ccc(-c3cccc(CN(Cc4ccccn4)S(=O)(=O)c4c(F)c(F)c(F)c(F)c4F)c3)cc12 |
| InChI | InChI=1S/C28H20F5N5O2S/c1-34-28-20-12-18(8-9-21(20)36-15-37-28)17-6-4-5-16(11-17)13-38(14-19-7-2-3-10-35-19)41(39,40)27-25(32)23(30)22(29)24(31)26(27)33/h2-12,15H,13-14H2,1H3,(H,34,36,37) |
| InChIKey | MXTRYRJCSGGPHG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|