5-hydroxy-3,4-dimethylphthalic acid

C10H10O5 — CID 87631435

IUPAC5-hydroxy-3,4-dimethylphthalic acid
SMILESCc1c(O)cc(C(=O)O)c(C(=O)O)c1C
InChIInChI=1S/C10H10O5/c1-4-5(2)8(10(14)15)6(9(12)13)3-7(4)11/h3,11H,1-2H3,(H,12,13)(H,14,15)
InChIKeyFTDGVPLXFFUFMO-UHFFFAOYSA-N
MW210.18 g/mol
LogP1.41
Rot. Bonds2

About 5-hydroxy-3,4-dimethylphthalic acid

5-hydroxy-3,4-dimethylphthalic acid (PubChem CID 87631435) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is 5-hydroxy-3,4-dimethylphthalic acid.

Molecular Properties

Compound Name5-hydroxy-3,4-dimethylphthalic acid
PubChem CID87631435
Molecular FormulaC10H10O5
Molecular Weight210.18 g/mol
Exact Mass210.05
IUPAC Name5-hydroxy-3,4-dimethylphthalic acid
SMILESCc1c(O)cc(C(=O)O)c(C(=O)O)c1C
InChIInChI=1S/C10H10O5/c1-4-5(2)8(10(14)15)6(9(12)13)3-7(4)11/h3,11H,1-2H3,(H,12,13)(H,14,15)
InChIKeyFTDGVPLXFFUFMO-UHFFFAOYSA-N
XLogP1.41
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.18
LogP ≤ 51.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 5-hydroxy-3,4-dimethylphthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-hydroxy-3,4-dimethylphthalic acid?
The IUPAC name of 5-hydroxy-3,4-dimethylphthalic acid (CID 87631435) is 5-hydroxy-3,4-dimethylphthalic acid.
What is the SMILES notation for 5-hydroxy-3,4-dimethylphthalic acid?
The canonical SMILES for 5-hydroxy-3,4-dimethylphthalic acid is Cc1c(O)cc(C(=O)O)c(C(=O)O)c1C.
What is the InChIKey of 5-hydroxy-3,4-dimethylphthalic acid?
The InChIKey is FTDGVPLXFFUFMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O5/c1-4-5(2)8(10(14)15)6(9(12)13)3-7(4)11/h3,11H,1-2H3,(H,12,13)(H,14,15).
What are the key properties of 5-hydroxy-3,4-dimethylphthalic acid?
5-hydroxy-3,4-dimethylphthalic acid has a molecular weight of 210.18 g/mol, XLogP of 1.41, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-3,4-dimethylphthalic acid is sourced from PubChem (CID 87631435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).