C10H10O5 — CID 87631435
5-hydroxy-3,4-dimethylphthalic acid (PubChem CID 87631435) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is 5-hydroxy-3,4-dimethylphthalic acid.
| Compound Name | 5-hydroxy-3,4-dimethylphthalic acid |
|---|---|
| PubChem CID | 87631435 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 5-hydroxy-3,4-dimethylphthalic acid |
| SMILES | Cc1c(O)cc(C(=O)O)c(C(=O)O)c1C |
| InChI | InChI=1S/C10H10O5/c1-4-5(2)8(10(14)15)6(9(12)13)3-7(4)11/h3,11H,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | FTDGVPLXFFUFMO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |