C20H16F3N3O5S — CID 87631477
N-[4-[5-(4-methylsulfonylphenyl)-3-oxo-2-(2,2,2-trifluoroethyl)pyridazin-4-yl]oxyphenyl]formamide (PubChem CID 87631477) has the molecular formula C20H16F3N3O5S and a molecular weight of 467.43 g/mol. Its IUPAC name is N-[4-[5-(4-methylsulfonylphenyl)-3-oxo-2-(2,2,2-trifluoroethyl)pyridazin-4-yl]oxyphenyl]formamide.
| Compound Name | N-[4-[5-(4-methylsulfonylphenyl)-3-oxo-2-(2,2,2-trifluoroethyl)pyridazin-4-yl]oxyphenyl]formamide |
|---|---|
| PubChem CID | 87631477 |
| Molecular Formula | C20H16F3N3O5S |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | N-[4-[5-(4-methylsulfonylphenyl)-3-oxo-2-(2,2,2-trifluoroethyl)pyridazin-4-yl]oxyphenyl]formamide |
| SMILES | CS(=O)(=O)c1ccc(-c2cnn(CC(F)(F)F)c(=O)c2Oc2ccc(NC=O)cc2)cc1 |
| InChI | InChI=1S/C20H16F3N3O5S/c1-32(29,30)16-8-2-13(3-9-16)17-10-25-26(11-20(21,22)23)19(28)18(17)31-15-6-4-14(5-7-15)24-12-27/h2-10,12H,11H2,1H3,(H,24,27) |
| InChIKey | XLNPAVCCTPOGKR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|