C23H14F6OS — CID 87631885
3-[3,3,4,4,5,5-hexafluoro-2-(3-methyl-1-benzothiophen-2-yl)cyclopenten-1-yl]-2-methyl-1-benzofuran (PubChem CID 87631885) has the molecular formula C23H14F6OS and a molecular weight of 452.42 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(3-methyl-1-benzothiophen-2-yl)cyclopenten-1-yl]-2-methyl-1-benzofuran.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(3-methyl-1-benzothiophen-2-yl)cyclopenten-1-yl]-2-methyl-1-benzofuran |
|---|---|
| PubChem CID | 87631885 |
| Molecular Formula | C23H14F6OS |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(3-methyl-1-benzothiophen-2-yl)cyclopenten-1-yl]-2-methyl-1-benzofuran |
| SMILES | Cc1oc2ccccc2c1C1=C(c2sc3ccccc3c2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C23H14F6OS/c1-11-13-7-4-6-10-16(13)31-20(11)19-18(21(24,25)23(28,29)22(19,26)27)17-12(2)30-15-9-5-3-8-14(15)17/h3-10H,1-2H3 |
| InChIKey | ABWCCHDAOARWEB-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|