About triphenylborane;tris(3-methylphenyl)phosphane
triphenylborane;tris(3-methylphenyl)phosphane (PubChem CID 87632532) has the molecular formula C39H36BP
and a molecular weight of 546.50 g/mol. Its IUPAC name is triphenylborane;tris(3-methylphenyl)phosphane.
Molecular Properties
| Compound Name | triphenylborane;tris(3-methylphenyl)phosphane |
| PubChem CID | 87632532 |
| Molecular Formula | C39H36BP |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | triphenylborane;tris(3-methylphenyl)phosphane |
| SMILES | Cc1cccc(P(c2cccc(C)c2)c2cccc(C)c2)c1.c1ccc(B(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21P.C18H15B/c1-16-7-4-10-19(13-16)22(20-11-5-8-17(2)14-20)21-12-6-9-18(3)15-21;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h4-15H,1-3H3;1-15H |
| InChIKey | RCJMSIKHMZUCRC-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenylborane;tris(3-methylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylborane;tris(3-methylphenyl)phosphane?
The IUPAC name of triphenylborane;tris(3-methylphenyl)phosphane (CID 87632532) is triphenylborane;tris(3-methylphenyl)phosphane.
What is the SMILES notation for triphenylborane;tris(3-methylphenyl)phosphane?
The canonical SMILES for triphenylborane;tris(3-methylphenyl)phosphane is Cc1cccc(P(c2cccc(C)c2)c2cccc(C)c2)c1.c1ccc(B(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of triphenylborane;tris(3-methylphenyl)phosphane?
The InChIKey is RCJMSIKHMZUCRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21P.C18H15B/c1-16-7-4-10-19(13-16)22(20-11-5-8-17(2)14-20)21-12-6-9-18(3)15-21;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h4-15H,1-3H3;1-15H.
What are the key properties of triphenylborane;tris(3-methylphenyl)phosphane?
triphenylborane;tris(3-methylphenyl)phosphane has a molecular weight of 546.50 g/mol, XLogP of 6.57, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylborane;tris(3-methylphenyl)phosphane is sourced from PubChem (CID 87632532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).