C21H18F6N6 — CID 87632736
5-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 87632736) has the molecular formula C21H18F6N6 and a molecular weight of 468.41 g/mol. Its IUPAC name is 5-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 5-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 87632736 |
| Molecular Formula | C21H18F6N6 |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 5-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | Nc1nc(N)c2c(n1)CCN(c1ncccc1C(F)(F)F)CC2c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F6N6/c22-20(23,24)12-5-3-11(4-6-12)13-10-33(18-14(21(25,26)27)2-1-8-30-18)9-7-15-16(13)17(28)32-19(29)31-15/h1-6,8,13H,7,9-10H2,(H4,28,29,31,32) |
| InChIKey | WCIYIXJRPMVSCO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |