C30H30N2O4 — CID 87633322
2-amino-2-[1-[(4-tert-butylphenyl)methyl]-5-(3-methylphenyl)indol-3-yl]-3,4-dioxobutanoic acid (PubChem CID 87633322) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-amino-2-[1-[(4-tert-butylphenyl)methyl]-5-(3-methylphenyl)indol-3-yl]-3,4-dioxobutanoic acid.
| Compound Name | 2-amino-2-[1-[(4-tert-butylphenyl)methyl]-5-(3-methylphenyl)indol-3-yl]-3,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 87633322 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 2-amino-2-[1-[(4-tert-butylphenyl)methyl]-5-(3-methylphenyl)indol-3-yl]-3,4-dioxobutanoic acid |
| SMILES | Cc1cccc(-c2ccc3c(c2)c(C(N)(C(=O)O)C(=O)C=O)cn3Cc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C30H30N2O4/c1-19-6-5-7-21(14-19)22-10-13-26-24(15-22)25(30(31,28(35)36)27(34)18-33)17-32(26)16-20-8-11-23(12-9-20)29(2,3)4/h5-15,17-18H,16,31H2,1-4H3,(H,35,36) |
| InChIKey | XUMUBNXGPBLNGB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|