C50H95O10PSi — CID 87633615
[(2R,3R,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3R)-3-methoxydecoxy]-5-[(Z)-octadec-11-enoxy]-6-[(E)-prop-1-enoxy]oxan-3-yl] bis(prop-2-enyl) phosphate (PubChem CID 87633615) has the molecular formula C50H95O10PSi and a molecular weight of 915.36 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3R)-3-methoxydecoxy]-5-[(Z)-octadec-11-enoxy]-6-[(E)-prop-1-enoxy]oxan-3-yl] bis(prop-2-enyl) phosphate.
| Compound Name | [(2R,3R,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3R)-3-methoxydecoxy]-5-[(Z)-octadec-11-enoxy]-6-[(E)-prop-1-enoxy]oxan-3-yl] bis(prop-2-enyl) phosphate |
|---|---|
| PubChem CID | 87633615 |
| Molecular Formula | C50H95O10PSi |
| Molecular Weight | 915.36 g/mol |
| Exact Mass | 914.64 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3R)-3-methoxydecoxy]-5-[(Z)-octadec-11-enoxy]-6-[(E)-prop-1-enoxy]oxan-3-yl] bis(prop-2-enyl) phosphate |
| SMILES | C=CCOP(=O)(OCC=C)O[C@H]1[C@H](OCC[C@@H](CCCCCCC)OC)[C@@H](OCCCCCCCCCC/C=C\CCCCCC)C(O/C=C/C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C50H95O10PSi/c1-12-17-19-21-22-23-24-25-26-27-28-29-30-31-33-35-41-53-48-47(54-42-37-44(52-9)36-34-32-20-18-13-2)46(60-61(51,56-39-15-4)57-40-16-5)45(59-49(48)55-38-14-3)43-58-62(10,11)50(6,7)8/h14-16,23-24,38,44-49H,4-5,12-13,17-22,25-37,39-43H2,1-3,6-11H3/b24-23-,38-14+/t44-,45-,46-,47+,48-,49?/m1/s1 |
| InChIKey | DYDJKZBTJDKFSZ-JYMYDZDOSA-N |
| XLogP | 14.76 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.36 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|