C29H42O3 — CID 87633627
3,5-ditert-butyl-4-(2,4-ditert-butylphenyl)-2-hydroxybenzoic acid (PubChem CID 87633627) has the molecular formula C29H42O3 and a molecular weight of 438.65 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-(2,4-ditert-butylphenyl)-2-hydroxybenzoic acid.
| Compound Name | 3,5-ditert-butyl-4-(2,4-ditert-butylphenyl)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 87633627 |
| Molecular Formula | C29H42O3 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | 3,5-ditert-butyl-4-(2,4-ditert-butylphenyl)-2-hydroxybenzoic acid |
| SMILES | CC(C)(C)c1ccc(-c2c(C(C)(C)C)cc(C(=O)O)c(O)c2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H42O3/c1-26(2,3)17-13-14-18(20(15-17)27(4,5)6)22-21(28(7,8)9)16-19(25(31)32)24(30)23(22)29(10,11)12/h13-16,30H,1-12H3,(H,31,32) |
| InChIKey | AEZHACZECBJRRY-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |