C12H11F5N4O — CID 87633879
5-(1,1,2,2,2-pentafluoroethyl)-1-(2-propoxyphenyl)tetrazole (PubChem CID 87633879) has the molecular formula C12H11F5N4O and a molecular weight of 322.24 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-1-(2-propoxyphenyl)tetrazole.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-1-(2-propoxyphenyl)tetrazole |
|---|---|
| PubChem CID | 87633879 |
| Molecular Formula | C12H11F5N4O |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-1-(2-propoxyphenyl)tetrazole |
| SMILES | CCCOc1ccccc1-n1nnnc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F5N4O/c1-2-7-22-9-6-4-3-5-8(9)21-10(18-19-20-21)11(13,14)12(15,16)17/h3-6H,2,7H2,1H3 |
| InChIKey | SMTJGGUKUNUBMY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|