C29H35BrFeNPSi-6 — CID 87634571
1-(2-bromo-5-diphenylphosphanyl-3-trimethylsilylcyclopenta-2,4-dien-1-yl)-N,N-dimethylethanamine;cyclopentane;iron (PubChem CID 87634571) has the molecular formula C29H35BrFeNPSi-6 and a molecular weight of 592.42 g/mol. Its IUPAC name is 1-(2-bromo-5-diphenylphosphanyl-3-trimethylsilylcyclopenta-2,4-dien-1-yl)-N,N-dimethylethanamine;cyclopentane;iron.
| Compound Name | 1-(2-bromo-5-diphenylphosphanyl-3-trimethylsilylcyclopenta-2,4-dien-1-yl)-N,N-dimethylethanamine;cyclopentane;iron |
|---|---|
| PubChem CID | 87634571 |
| Molecular Formula | C29H35BrFeNPSi-6 |
| Molecular Weight | 592.42 g/mol |
| Exact Mass | 591.08 |
| IUPAC Name | 1-(2-bromo-5-diphenylphosphanyl-3-trimethylsilylcyclopenta-2,4-dien-1-yl)-N,N-dimethylethanamine;cyclopentane;iron |
| SMILES | CC([c-]1c(P(c2ccccc2)c2ccccc2)cc([Si](C)(C)C)c1Br)N(C)C.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C24H30BrNPSi.C5H5.Fe/c1-18(26(2)3)23-21(17-22(24(23)25)28(4,5)6)27(19-13-9-7-10-14-19)20-15-11-8-12-16-20;1-2-4-5-3-1;/h7-18H,1-6H3;1-5H;/q-1;-5; |
| InChIKey | BDGZNPHBTDOHPO-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.42 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|