C12H16F3N3O5 — CID 87634833
(2,5-dioxopyrrolidin-1-yl) (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 87634833) has the molecular formula C12H16F3N3O5 and a molecular weight of 339.27 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 87634833 |
| Molecular Formula | C12H16F3N3O5 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoate |
| SMILES | NCCCC[C@H](NC(=O)C(F)(F)F)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H16F3N3O5/c13-12(14,15)11(22)17-7(3-1-2-6-16)10(21)23-18-8(19)4-5-9(18)20/h7H,1-6,16H2,(H,17,22)/t7-/m0/s1 |
| InChIKey | PALRODTYPYVXHN-ZETCQYMHSA-N |
| XLogP | -0.23 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|