C20H28N2O5S — CID 87635076
[(6E,8S,9S,13S,14S)-13-ethyl-6-hydroxyimino-2-methoxy-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 87635076) has the molecular formula C20H28N2O5S and a molecular weight of 408.52 g/mol. Its IUPAC name is [(6E,8S,9S,13S,14S)-13-ethyl-6-hydroxyimino-2-methoxy-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(6E,8S,9S,13S,14S)-13-ethyl-6-hydroxyimino-2-methoxy-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 87635076 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [(6E,8S,9S,13S,14S)-13-ethyl-6-hydroxyimino-2-methoxy-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | CC[C@@]12CCC[C@H]1[C@@H]1C/C(=N\O)c3cc(OS(N)(=O)=O)c(OC)cc3[C@H]1CC2 |
| InChI | InChI=1S/C20H28N2O5S/c1-3-20-7-4-5-16(20)14-9-17(22-23)15-11-19(27-28(21,24)25)18(26-2)10-13(15)12(14)6-8-20/h10-12,14,16,23H,3-9H2,1-2H3,(H2,21,24,25)/b22-17+/t12-,14-,16+,20+/m1/s1 |
| InChIKey | NEWSBRQIOADDMQ-DYLWAKFJSA-N |
| XLogP | 3.55 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|